C21H19N3O3S — CID 135398782
propan-2-yl 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate (PubChem CID 135398782) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is propan-2-yl 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate.
| Compound Name | propan-2-yl 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 135398782 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | propan-2-yl 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1c1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-12(2)27-21(26)13-7-9-14(10-8-13)24-11-16(25)18(19(24)22)20-23-15-5-3-4-6-17(15)28-20/h3-10,12,22,25H,11H2,1-2H3/b22-19- |
| InChIKey | ZOGIJYXEOZZBPE-QOCHGBHMSA-N |
| XLogP | 4.63 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|