C17H21N3O2S — CID 136724883
4-(1,3-benzothiazol-2-yl)-5-imino-1-(3-propan-2-yloxypropyl)-2H-pyrrol-3-ol (PubChem CID 136724883) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-imino-1-(3-propan-2-yloxypropyl)-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-(3-propan-2-yloxypropyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724883 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-(3-propan-2-yloxypropyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1CCCOC(C)C |
| InChI | InChI=1S/C17H21N3O2S/c1-11(2)22-9-5-8-20-10-13(21)15(16(20)18)17-19-12-6-3-4-7-14(12)23-17/h3-4,6-7,11,18,21H,5,8-10H2,1-2H3/b18-16- |
| InChIKey | CNFIYVGDQHTNFI-VLGSPTGOSA-N |
| XLogP | 3.67 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|