C17H16N4OS2 — CID 135637054
4-(1,3-benzothiazol-2-yl)-5-imino-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-2H-pyrrol-3-ol (PubChem CID 135637054) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-imino-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135637054 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1CCc1nc(C)cs1 |
| InChI | InChI=1S/C17H16N4OS2/c1-10-9-23-14(19-10)6-7-21-8-12(22)15(16(21)18)17-20-11-4-2-3-5-13(11)24-17/h2-5,9,18,22H,6-8H2,1H3/b18-16- |
| InChIKey | VARMPTYJCOHXBA-VLGSPTGOSA-N |
| XLogP | 3.87 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|