C23H25N3O3S — CID 136837097
4-(1,3-benzothiazol-2-yl)-1-[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-5-imino-2H-pyrrol-3-ol (PubChem CID 136837097) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1-[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1-[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136837097 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1-[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1[C@H](c1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C23H25N3O3S/c1-13(2)21(14-9-10-17(28-3)18(11-14)29-4)26-12-16(27)20(22(26)24)23-25-15-7-5-6-8-19(15)30-23/h5-11,13,21,24,27H,12H2,1-4H3/b24-22-/t21-/m0/s1 |
| InChIKey | XTEIXOORPUCIFW-INZAYJCZSA-N |
| XLogP | 5.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|