C22H20N4O4S2 — CID 136766250
4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 136766250) has the molecular formula C22H20N4O4S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 136766250 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1c1ccc(C(=O)N[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H20N4O4S2/c23-20-19(22-25-16-3-1-2-4-18(16)31-22)17(27)11-26(20)15-7-5-13(6-8-15)21(28)24-14-9-10-32(29,30)12-14/h1-8,14,23,27H,9-12H2,(H,24,28)/b23-20-/t14-/m0/s1 |
| InChIKey | ZGZDFKWMIBDZSZ-KPRDTPMASA-N |
| XLogP | 2.98 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|