C22H21N3O3S2 — CID 136725862
2-methylpropyl 4-[3-hydroxy-5-imino-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]benzoate (PubChem CID 136725862) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-hydroxy-5-imino-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[3-hydroxy-5-imino-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 136725862 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-methylpropyl 4-[3-hydroxy-5-imino-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc(-c3cccs3)cs2)=C(O)CN1c1ccc(C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C22H21N3O3S2/c1-13(2)11-28-22(27)14-5-7-15(8-6-14)25-10-17(26)19(20(25)23)21-24-16(12-30-21)18-4-3-9-29-18/h3-9,12-13,23,26H,10-11H2,1-2H3/b23-20- |
| InChIKey | BUQCPFROYCCOFW-ATJXCDBQSA-N |
| XLogP | 5.45 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|