C21H17ClFN3O3S — CID 135653217
1-(3-chloro-4-fluorophenyl)-4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 135653217) has the molecular formula C21H17ClFN3O3S and a molecular weight of 445.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135653217 |
| Molecular Formula | C21H17ClFN3O3S |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(OC)c(OC)c3)cs2)=C(O)CN1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H17ClFN3O3S/c1-28-17-6-3-11(7-18(17)29-2)15-10-30-21(25-15)19-16(27)9-26(20(19)24)12-4-5-14(23)13(22)8-12/h3-8,10,24,27H,9H2,1-2H3/b24-20- |
| InChIKey | BVTMWAOBMRZMIA-GFMRDNFCSA-N |
| XLogP | 5.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|