C20H15ClFN3OS — CID 135869085
4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-(3-fluoro-4-methylphenyl)-5-imino-2H-pyrrol-3-ol (PubChem CID 135869085) has the molecular formula C20H15ClFN3OS and a molecular weight of 399.88 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-(3-fluoro-4-methylphenyl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-(3-fluoro-4-methylphenyl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135869085 |
| Molecular Formula | C20H15ClFN3OS |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-(3-fluoro-4-methylphenyl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3cccc(Cl)c3)cs2)=C(O)CN1c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C20H15ClFN3OS/c1-11-5-6-14(8-15(11)22)25-9-17(26)18(19(25)23)20-24-16(10-27-20)12-3-2-4-13(21)7-12/h2-8,10,23,26H,9H2,1H3/b23-19- |
| InChIKey | KJZKCXNRZOXYQI-NMWGTECJSA-N |
| XLogP | 5.68 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|