C16H14ClN3OS — CID 135872609
4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-cyclopropyl-5-imino-2H-pyrrol-3-ol (PubChem CID 135872609) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-cyclopropyl-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-cyclopropyl-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135872609 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-1-cyclopropyl-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3cccc(Cl)c3)cs2)=C(O)CN1C1CC1 |
| InChI | InChI=1S/C16H14ClN3OS/c17-10-3-1-2-9(6-10)12-8-22-16(19-12)14-13(21)7-20(15(14)18)11-4-5-11/h1-3,6,8,11,18,21H,4-5,7H2/b18-15- |
| InChIKey | SUVYWBJLMJGQBX-SDXDJHTJSA-N |
| XLogP | 4.19 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|