C25H25FN4OS — CID 135637099
1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 135637099) has the molecular formula C25H25FN4OS and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135637099 |
| Molecular Formula | C25H25FN4OS |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H25FN4OS/c26-19-8-6-17(7-9-19)14-29-12-10-20(11-13-29)30-15-22(31)23(24(30)27)25-28-21(16-32-25)18-4-2-1-3-5-18/h1-9,16,20,27,31H,10-15H2/b27-24- |
| InChIKey | CRDZHNRMTWVSBC-PNHLSOANSA-N |
| XLogP | 5.18 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|