C21H15F4N3OS — CID 135872635
1-[(4-fluorophenyl)methyl]-5-imino-4-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2H-pyrrol-3-ol (PubChem CID 135872635) has the molecular formula C21H15F4N3OS and a molecular weight of 433.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-imino-4-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2H-pyrrol-3-ol.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-imino-4-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135872635 |
| Molecular Formula | C21H15F4N3OS |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-imino-4-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3cccc(C(F)(F)F)c3)cs2)=C(O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H15F4N3OS/c22-15-6-4-12(5-7-15)9-28-10-17(29)18(19(28)26)20-27-16(11-30-20)13-2-1-3-14(8-13)21(23,24)25/h1-8,11,26,29H,9-10H2/b26-19- |
| InChIKey | JOHMYZGRRKCQLE-XHPQRKPJSA-N |
| XLogP | 5.73 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|