C16H16FN3OS — CID 135888432
4-(4-ethyl-1,3-thiazol-2-yl)-1-[(4-fluorophenyl)methyl]-5-imino-2H-pyrrol-3-ol (PubChem CID 135888432) has the molecular formula C16H16FN3OS and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(4-ethyl-1,3-thiazol-2-yl)-1-[(4-fluorophenyl)methyl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(4-ethyl-1,3-thiazol-2-yl)-1-[(4-fluorophenyl)methyl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135888432 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-(4-ethyl-1,3-thiazol-2-yl)-1-[(4-fluorophenyl)methyl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(CC)cs2)=C(O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN3OS/c1-2-12-9-22-16(19-12)14-13(21)8-20(15(14)18)7-10-3-5-11(17)6-4-10/h3-6,9,18,21H,2,7-8H2,1H3/b18-15- |
| InChIKey | JWBWDMJTGMPVQU-SDXDJHTJSA-N |
| XLogP | 3.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|