C25H20N4OS — CID 136652447
5-imino-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol (PubChem CID 136652447) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is 5-imino-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136652447 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 5-imino-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(-c4ccccc4)cc3)cs2)=C(O)CN1Cc1cccnc1 |
| InChI | InChI=1S/C25H20N4OS/c26-24-23(22(30)15-29(24)14-17-5-4-12-27-13-17)25-28-21(16-31-25)20-10-8-19(9-11-20)18-6-2-1-3-7-18/h1-13,16,26,30H,14-15H2/b26-24- |
| InChIKey | ZFIFHRMGAMFREX-LCUIJRPUSA-N |
| XLogP | 5.63 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|