C19H15BrN4OS — CID 135521118
4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-imino-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol (PubChem CID 135521118) has the molecular formula C19H15BrN4OS and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-imino-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-imino-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135521118 |
| Molecular Formula | C19H15BrN4OS |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-5-imino-1-(pyridin-3-ylmethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Br)cc3)cs2)=C(O)CN1Cc1cccnc1 |
| InChI | InChI=1S/C19H15BrN4OS/c20-14-5-3-13(4-6-14)15-11-26-19(23-15)17-16(25)10-24(18(17)21)9-12-2-1-7-22-8-12/h1-8,11,21,25H,9-10H2/b21-18- |
| InChIKey | ZFHSHYZRGTYVBX-UZYVYHOESA-N |
| XLogP | 4.73 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|