C22H18N4OS — CID 135888356
4-[2-[3-hydroxy-5-imino-1-(2-phenylethyl)-2H-pyrrol-4-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 135888356) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[2-[3-hydroxy-5-imino-1-(2-phenylethyl)-2H-pyrrol-4-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[3-hydroxy-5-imino-1-(2-phenylethyl)-2H-pyrrol-4-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 135888356 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[2-[3-hydroxy-5-imino-1-(2-phenylethyl)-2H-pyrrol-4-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(C#N)cc3)cs2)=C(O)CN1CCc1ccccc1 |
| InChI | InChI=1S/C22H18N4OS/c23-12-16-6-8-17(9-7-16)18-14-28-22(25-18)20-19(27)13-26(21(20)24)11-10-15-4-2-1-3-5-15/h1-9,14,24,27H,10-11,13H2/b24-21- |
| InChIKey | PTWIEHKYMVOFQG-FLFQWRMESA-N |
| XLogP | 4.49 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|