C24H24N6OS — CID 135637006
5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-1-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]-2H-pyrrol-3-ol (PubChem CID 135637006) has the molecular formula C24H24N6OS and a molecular weight of 444.56 g/mol. Its IUPAC name is 5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-1-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-1-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135637006 |
| Molecular Formula | C24H24N6OS |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 5-imino-4-(4-phenyl-1,3-thiazol-2-yl)-1-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3)cs2)=C(O)CN1CCCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C24H24N6OS/c25-23-22(24-26-18(16-32-24)17-9-3-1-4-10-17)19(31)15-29(23)13-7-2-5-11-20-27-28-21-12-6-8-14-30(20)21/h1,3-4,6,8-10,12,14,16,25,31H,2,5,7,11,13,15H2/b25-23- |
| InChIKey | KKQCGKMOVKWZEP-BZZOAKBMSA-N |
| XLogP | 4.83 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|