C19H24ClN4OS+ — CID 135723785
2-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]ethyl-diethylazanium (PubChem CID 135723785) has the molecular formula C19H24ClN4OS+ and a molecular weight of 391.95 g/mol. Its IUPAC name is 2-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 135723785 |
| Molecular Formula | C19H24ClN4OS+ |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]ethyl-diethylazanium |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1CC[NH+](CC)CC |
| InChI | InChI=1S/C19H23ClN4OS/c1-3-23(4-2)9-10-24-11-16(25)17(18(24)21)19-22-15(12-26-19)13-5-7-14(20)8-6-13/h5-8,12,21,25H,3-4,9-11H2,1-2H3/p+1/b21-18- |
| InChIKey | NIOKLBPYEXLZSR-UZYVYHOESA-O |
| XLogP | 2.95 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|