C19H21ClN4O3S3 — CID 135636989
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(2-thiomorpholin-4-ylsulfonylethyl)-2H-pyrrol-3-ol (PubChem CID 135636989) has the molecular formula C19H21ClN4O3S3 and a molecular weight of 485.06 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(2-thiomorpholin-4-ylsulfonylethyl)-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(2-thiomorpholin-4-ylsulfonylethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135636989 |
| Molecular Formula | C19H21ClN4O3S3 |
| Molecular Weight | 485.06 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-imino-1-(2-thiomorpholin-4-ylsulfonylethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1CCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C19H21ClN4O3S3/c20-14-3-1-13(2-4-14)15-12-29-19(22-15)17-16(25)11-23(18(17)21)7-10-30(26,27)24-5-8-28-9-6-24/h1-4,12,21,25H,5-11H2/b21-18- |
| InChIKey | VTQRIYNZYUPLMF-UZYVYHOESA-N |
| XLogP | 3.40 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.06 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|