C13H19N3O2S — CID 136725582
5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(2-propan-2-yloxyethyl)-2H-pyrrol-3-ol (PubChem CID 136725582) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(2-propan-2-yloxyethyl)-2H-pyrrol-3-ol.
| Compound Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(2-propan-2-yloxyethyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136725582 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-(2-propan-2-yloxyethyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C)cs2)=C(O)CN1CCOC(C)C |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)18-5-4-16-6-10(17)11(12(16)14)13-15-9(3)7-19-13/h7-8,14,17H,4-6H2,1-3H3/b14-12- |
| InChIKey | TWRANTLLNKALNH-OWBHPGMISA-N |
| XLogP | 2.44 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|