C23H24N2O2S — CID 11902615
(1R,2R,6S,7S)-4-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11902615) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11902615 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (1R,2R,6S,7S)-4-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(-c2csc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3CC[C@@H]4C3=C(C)C)n2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-4-13-5-7-14(8-6-13)17-11-28-23(24-17)25-21(26)19-15-9-10-16(18(15)12(2)3)20(19)22(25)27/h5-8,11,15-16,19-20H,4,9-10H2,1-3H3/t15-,16+,19+,20- |
| InChIKey | TWJGMHCAJOYFQT-OBMJPTGESA-N |
| XLogP | 4.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|