C22H21ClN2O2S — CID 98336701
(1R,2S,6S,7R)-4-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98336701) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98336701 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (1R,2S,6S,7R)-4-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)=C1[C@@H]2CC[C@@H]1[C@@H]1C(=O)N(c3nc(-c4ccc(Cl)cc4)c(C)s3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-10(2)16-14-8-9-15(16)18-17(14)20(26)25(21(18)27)22-24-19(11(3)28-22)12-4-6-13(23)7-5-12/h4-7,14-15,17-18H,8-9H2,1-3H3/t14-,15-,17-,18-/m0/s1 |
| InChIKey | ZXAOMJKVEMPICG-LAQRGFTBSA-N |
| XLogP | 5.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|