C28H30N2O2S — CID 98218431
4-[4-[(2S)-butan-2-yl]phenyl]-2-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-methylthiophene-3-carbonitrile (PubChem CID 98218431) has the molecular formula C28H30N2O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-[4-[(2S)-butan-2-yl]phenyl]-2-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-methylthiophene-3-carbonitrile.
| Compound Name | 4-[4-[(2S)-butan-2-yl]phenyl]-2-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-methylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 98218431 |
| Molecular Formula | C28H30N2O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-[4-[(2S)-butan-2-yl]phenyl]-2-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-methylthiophene-3-carbonitrile |
| SMILES | CC[C@H](C)c1ccc(-c2c(C)sc(N3C(=O)[C@@H]4[C@@H](C3=O)[C@@H]3CC[C@@H]4C3=C(C)C)c2C#N)cc1 |
| InChI | InChI=1S/C28H30N2O2S/c1-6-15(4)17-7-9-18(10-8-17)23-16(5)33-28(21(23)13-29)30-26(31)24-19-11-12-20(22(19)14(2)3)25(24)27(30)32/h7-10,15,19-20,24-25H,6,11-12H2,1-5H3/t15-,19+,20+,24-,25-/m0/s1 |
| InChIKey | IEKPREJNOKFOGB-CEZRPIRXSA-N |
| XLogP | 6.59 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|