C25H28N2O2S — CID 40609579
(1R,2S,6S,7S)-4-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 40609579) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is (1R,2S,6S,7S)-4-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7S)-4-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 40609579 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (1R,2S,6S,7S)-4-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@@H]1C(=O)N(c3nc(-c4ccc(CC(C)C)cc4)cs3)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H28N2O2S/c1-13(2)11-15-5-7-16(8-6-15)19-12-30-25(26-19)27-23(28)21-17-9-10-18(20(17)14(3)4)22(21)24(27)29/h5-8,12-13,17-18,21-22H,9-11H2,1-4H3/t17-,18+,21-,22-/m0/s1 |
| InChIKey | JESHWTBYGPEYMA-UDKICSLYSA-N |
| XLogP | 5.49 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|