C7H10N2O4S — CID 51721408
3-[(3R)-1,1-dioxothiolan-3-yl]imidazolidine-2,4-dione (PubChem CID 51721408) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 3-[(3R)-1,1-dioxothiolan-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[(3R)-1,1-dioxothiolan-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51721408 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3-[(3R)-1,1-dioxothiolan-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10N2O4S/c10-6-3-8-7(11)9(6)5-1-2-14(12,13)4-5/h5H,1-4H2,(H,8,11)/t5-/m1/s1 |
| InChIKey | KEMVFQYQOWNWQR-RXMQYKEDSA-N |
| XLogP | -1.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|