C7H8N2O5S — CID 43131900
1-(1,1-dioxothiolan-3-yl)imidazolidine-2,4,5-trione (PubChem CID 43131900) has the molecular formula C7H8N2O5S and a molecular weight of 232.22 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 43131900 |
| Molecular Formula | C7H8N2O5S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C7H8N2O5S/c10-5-6(11)9(7(12)8-5)4-1-2-15(13,14)3-4/h4H,1-3H2,(H,8,10,12) |
| InChIKey | YKMXWWNVVFTAQV-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|