C12H18N2O4S — CID 64957014
9-(1,1-dioxothiolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64957014) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 9-(1,1-dioxothiolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-(1,1-dioxothiolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64957014 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 9-(1,1-dioxothiolan-3-yl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | O=C1CN(C2CCS(=O)(=O)C2)C(=O)C2(CCCC2)N1 |
| InChI | InChI=1S/C12H18N2O4S/c15-10-7-14(9-3-6-19(17,18)8-9)11(16)12(13-10)4-1-2-5-12/h9H,1-8H2,(H,13,15) |
| InChIKey | GSLPZQHPBXKDJJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |