C9H12N2O2 — CID 121207254
7-cyclopropyl-4,7-diazaspiro[2.5]octane-5,8-dione (PubChem CID 121207254) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 7-cyclopropyl-4,7-diazaspiro[2.5]octane-5,8-dione.
| Compound Name | 7-cyclopropyl-4,7-diazaspiro[2.5]octane-5,8-dione |
|---|---|
| PubChem CID | 121207254 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 7-cyclopropyl-4,7-diazaspiro[2.5]octane-5,8-dione |
| SMILES | O=C1CN(C2CC2)C(=O)C2(CC2)N1 |
| InChI | InChI=1S/C9H12N2O2/c12-7-5-11(6-1-2-6)8(13)9(10-7)3-4-9/h6H,1-5H2,(H,10,12) |
| InChIKey | MOKVVWYQHLTXLW-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |