C10H13NO4S — CID 63921778
1-(1,1-dioxothian-3-yl)-3-methylpyrrole-2,5-dione (PubChem CID 63921778) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-3-methylpyrrole-2,5-dione.
| Compound Name | 1-(1,1-dioxothian-3-yl)-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 63921778 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(C2CCCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C10H13NO4S/c1-7-5-9(12)11(10(7)13)8-3-2-4-16(14,15)6-8/h5,8H,2-4,6H2,1H3 |
| InChIKey | KOWSKUFHAWQNIL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|