C9H14N2O2S — CID 84734851
3-(4-methylpyrazol-1-yl)thiane 1,1-dioxide (PubChem CID 84734851) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-(4-methylpyrazol-1-yl)thiane 1,1-dioxide.
| Compound Name | 3-(4-methylpyrazol-1-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 84734851 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(4-methylpyrazol-1-yl)thiane 1,1-dioxide |
| SMILES | Cc1cnn(C2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C9H14N2O2S/c1-8-5-10-11(6-8)9-3-2-4-14(12,13)7-9/h5-6,9H,2-4,7H2,1H3 |
| InChIKey | ZSRHLCWLYJCIHS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |