C10H16N2O3S — CID 62729829
1-[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-ol (PubChem CID 62729829) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-ol.
| Compound Name | 1-[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 62729829 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-ol |
| SMILES | CCC(O)c1cnn(C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C10H16N2O3S/c1-2-10(13)8-5-11-12(6-8)9-3-4-16(14,15)7-9/h5-6,9-10,13H,2-4,7H2,1H3 |
| InChIKey | DQKGJXOZRCNWPS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |