C20H29N3O2S — CID 154869262
2-(4-butylphenyl)-N-[[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 154869262) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-(4-butylphenyl)-N-[[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(4-butylphenyl)-N-[[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 154869262 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-(4-butylphenyl)-N-[[1-(1,1-dioxothiolan-3-yl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCCCc1ccc(CCNCc2cnn(C3CCS(=O)(=O)C3)c2)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-2-3-4-17-5-7-18(8-6-17)9-11-21-13-19-14-22-23(15-19)20-10-12-26(24,25)16-20/h5-8,14-15,20-21H,2-4,9-13,16H2,1H3 |
| InChIKey | BYXOMMRCMZQHPR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|