C11H17NO3S — CID 62739939
8-(1,1-dioxothiolan-3-yl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 62739939) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 8-(1,1-dioxothiolan-3-yl)-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 8-(1,1-dioxothiolan-3-yl)-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 62739939 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 8-(1,1-dioxothiolan-3-yl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1CC2CCC(C1)N2C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO3S/c13-11-5-8-1-2-9(6-11)12(8)10-3-4-16(14,15)7-10/h8-10H,1-7H2 |
| InChIKey | HYELCZBZERFLOM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |