C8H11NO4S — CID 79517072
1-(1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione (PubChem CID 79517072) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 79517072 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione |
| SMILES | O=C1CC(=O)N(C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C8H11NO4S/c10-7-3-8(11)9(4-7)6-1-2-14(12,13)5-6/h6H,1-5H2 |
| InChIKey | IJUVKBRAZSBQHM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|