C14H22N2O4S — CID 64957132
3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)piperazine-2,5-dione (PubChem CID 64957132) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)piperazine-2,5-dione.
| Compound Name | 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64957132 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)piperazine-2,5-dione |
| SMILES | O=C1CN(C2CCS(=O)(=O)C2)C(=O)C(C2CCCCC2)N1 |
| InChI | InChI=1S/C14H22N2O4S/c17-12-8-16(11-6-7-21(19,20)9-11)14(18)13(15-12)10-4-2-1-3-5-10/h10-11,13H,1-9H2,(H,15,17) |
| InChIKey | CKAABUGYVZJMBT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |