C12H20N2O4S — CID 64971666
1-(1,1-dioxothian-3-yl)-3-propylpiperazine-2,5-dione (PubChem CID 64971666) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-3-propylpiperazine-2,5-dione.
| Compound Name | 1-(1,1-dioxothian-3-yl)-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64971666 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-3-propylpiperazine-2,5-dione |
| SMILES | CCCC1NC(=O)CN(C2CCCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C12H20N2O4S/c1-2-4-10-12(16)14(7-11(15)13-10)9-5-3-6-19(17,18)8-9/h9-10H,2-8H2,1H3,(H,13,15) |
| InChIKey | PHOQHJWKOIXVQJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |