C9H15NO4S — CID 117013989
1-(1,1-dioxothiolan-3-yl)-4-hydroxypiperidin-2-one (PubChem CID 117013989) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-hydroxypiperidin-2-one.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 117013989 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-hydroxypiperidin-2-one |
| SMILES | O=C1CC(O)CCN1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO4S/c11-8-1-3-10(9(12)5-8)7-2-4-15(13,14)6-7/h7-8,11H,1-6H2 |
| InChIKey | WWCQNHLNGRNCFR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |