C11H20N2O3S — CID 117023661
4-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-1,4-diazepan-5-one (PubChem CID 117023661) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023661 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-2,2-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CN(C2CCS(=O)(=O)C2)C(=O)CCN1 |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2)8-13(10(14)3-5-12-11)9-4-6-17(15,16)7-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | XBTYSTIAIOVAHY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |