C11H19NO3S — CID 117019113
1-(1,1-dioxothiolan-3-yl)-2,2-dimethylpiperidin-3-one (PubChem CID 117019113) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2,2-dimethylpiperidin-3-one.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2,2-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 117019113 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2,2-dimethylpiperidin-3-one |
| SMILES | CC1(C)C(=O)CCCN1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO3S/c1-11(2)10(13)4-3-6-12(11)9-5-7-16(14,15)8-9/h9H,3-8H2,1-2H3 |
| InChIKey | OHIOPYDRHLZTOS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |