C9H13NO4S4 — CID 11899969
(3aR,6aR)-3-[(3R)-1,1-dioxothiolan-3-yl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 11899969) has the molecular formula C9H13NO4S4 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3aR,6aR)-3-[(3R)-1,1-dioxothiolan-3-yl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | (3aR,6aR)-3-[(3R)-1,1-dioxothiolan-3-yl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 11899969 |
| Molecular Formula | C9H13NO4S4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | (3aR,6aR)-3-[(3R)-1,1-dioxothiolan-3-yl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | O=S1(=O)CC[C@@H](N2C(=S)S[C@H]3CS(=O)(=O)C[C@H]32)C1 |
| InChI | InChI=1S/C9H13NO4S4/c11-17(12)2-1-6(3-17)10-7-4-18(13,14)5-8(7)16-9(10)15/h6-8H,1-5H2/t6-,7-,8+/m1/s1 |
| InChIKey | DBENEADLWSFRQB-PRJMDXOYSA-N |
| XLogP | -0.33 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|