C9H11NO4S4 — CID 7008778
(6aS)-3-[(3S)-1,1-dioxothiolan-3-yl]-5,5-dioxo-6,6a-dihydrothieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 7008778) has the molecular formula C9H11NO4S4 and a molecular weight of 325.46 g/mol. Its IUPAC name is (6aS)-3-[(3S)-1,1-dioxothiolan-3-yl]-5,5-dioxo-6,6a-dihydrothieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | (6aS)-3-[(3S)-1,1-dioxothiolan-3-yl]-5,5-dioxo-6,6a-dihydrothieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 7008778 |
| Molecular Formula | C9H11NO4S4 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | (6aS)-3-[(3S)-1,1-dioxothiolan-3-yl]-5,5-dioxo-6,6a-dihydrothieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | O=S1(=O)C=C2[C@@H](C1)SC(=S)N2[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H11NO4S4/c11-17(12)2-1-6(3-17)10-7-4-18(13,14)5-8(7)16-9(10)15/h4,6,8H,1-3,5H2/t6-,8+/m0/s1 |
| InChIKey | FPEXFXWVTCTXPU-POYBYMJQSA-N |
| XLogP | 0.15 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|