C12H17N3O3 — CID 112598149
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 112598149) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598149 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(C2CCN3CCCC3C2)C(=O)N1 |
| InChI | InChI=1S/C12H17N3O3/c16-10-7-11(17)15(12(18)13-10)9-3-5-14-4-1-2-8(14)6-9/h8-9H,1-7H2,(H,13,16,18) |
| InChIKey | NITHNTQKIZGXLM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|