C10H11N3O5 — CID 112598094
1-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 112598094) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is 1-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598094 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)CCC(N2C(=O)CC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C10H11N3O5/c1-12-7(15)3-2-5(9(12)17)13-8(16)4-6(14)11-10(13)18/h5H,2-4H2,1H3,(H,11,14,18) |
| InChIKey | CNQMMLXCHWMTLQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|