C13H12N2O4 — CID 112597991
1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 112597991) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112597991 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(C2CCOc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O4/c16-11-7-12(17)15(13(18)14-11)9-5-6-19-10-4-2-1-3-8(9)10/h1-4,9H,5-7H2,(H,14,16,18) |
| InChIKey | HKZWRUQNQRBWJD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|