C13H16N2O2 — CID 113296325
1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinan-2-one (PubChem CID 113296325) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 113296325 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CCOc2ccccc21 |
| InChI | InChI=1S/C13H16N2O2/c16-13-14-7-3-8-15(13)11-6-9-17-12-5-2-1-4-10(11)12/h1-2,4-5,11H,3,6-9H2,(H,14,16) |
| InChIKey | NWCYCODBMIPTSS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |