C15H13N3O4 — CID 139469799
2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-(methylideneamino)isoindole-1,3-dione (PubChem CID 139469799) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-(methylideneamino)isoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-(methylideneamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139469799 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-(methylideneamino)isoindole-1,3-dione |
| SMILES | C=Nc1ccc2c(c1)C(=O)N(C1CCC(=O)N(C)C1=O)C2=O |
| InChI | InChI=1S/C15H13N3O4/c1-16-8-3-4-9-10(7-8)14(21)18(13(9)20)11-5-6-12(19)17(2)15(11)22/h3-4,7,11H,1,5-6H2,2H3 |
| InChIKey | OSNOSHLEODNFOS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|