C12H26N2O2S — CID 117016617
3,3-dimethyl-2-pentyl-1,2,5-thiadiazocane 1,1-dioxide (PubChem CID 117016617) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3,3-dimethyl-2-pentyl-1,2,5-thiadiazocane 1,1-dioxide.
| Compound Name | 3,3-dimethyl-2-pentyl-1,2,5-thiadiazocane 1,1-dioxide |
|---|---|
| PubChem CID | 117016617 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3,3-dimethyl-2-pentyl-1,2,5-thiadiazocane 1,1-dioxide |
| SMILES | CCCCCN1C(C)(C)CNCCCS1(=O)=O |
| InChI | InChI=1S/C12H26N2O2S/c1-4-5-6-9-14-12(2,3)11-13-8-7-10-17(14,15)16/h13H,4-11H2,1-3H3 |
| InChIKey | NQHGTLNSNARTFR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|