About 3-decyl-3-ethylazetidine
3-decyl-3-ethylazetidine (PubChem CID 79451957) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is 3-decyl-3-ethylazetidine.
Molecular Properties
| Compound Name | 3-decyl-3-ethylazetidine |
| PubChem CID | 79451957 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 3-decyl-3-ethylazetidine |
| SMILES | CCCCCCCCCCC1(CC)CNC1 |
| InChI | InChI=1S/C15H31N/c1-3-5-6-7-8-9-10-11-12-15(4-2)13-16-14-15/h16H,3-14H2,1-2H3 |
| InChIKey | HARCBNKUBNONKG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decyl-3-ethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decyl-3-ethylazetidine?
The IUPAC name of 3-decyl-3-ethylazetidine (CID 79451957) is 3-decyl-3-ethylazetidine.
What is the SMILES notation for 3-decyl-3-ethylazetidine?
The canonical SMILES for 3-decyl-3-ethylazetidine is CCCCCCCCCCC1(CC)CNC1.
What is the InChIKey of 3-decyl-3-ethylazetidine?
The InChIKey is HARCBNKUBNONKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-3-5-6-7-8-9-10-11-12-15(4-2)13-16-14-15/h16H,3-14H2,1-2H3.
What are the key properties of 3-decyl-3-ethylazetidine?
3-decyl-3-ethylazetidine has a molecular weight of 225.42 g/mol, XLogP of 4.52, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decyl-3-ethylazetidine is sourced from PubChem (CID 79451957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).