About 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide
3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 117016778) has the molecular formula C11H24N2O2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide.
Analyze 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide?
The IUPAC name of 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide (CID 117016778) is 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide.
What is the SMILES notation for 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide?
The canonical SMILES for 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide is CC(C)CCN1C(C)(C)CNCCS1(=O)=O.
What is the InChIKey of 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide?
The InChIKey is NDSYYMFCVZGBBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2S/c1-10(2)5-7-13-11(3,4)9-12-6-8-16(13,14)15/h10,12H,5-9H2,1-4H3.
What are the key properties of 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide?
3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide has a molecular weight of 248.39 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-(3-methylbutyl)-1,2,5-thiadiazepane 1,1-dioxide is sourced from PubChem (CID 117016778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).