C18H36N2 — CID 64844428
6-decyl-6,9-diazaspiro[4.5]decane (PubChem CID 64844428) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 6-decyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 6-decyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64844428 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 6-decyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCCCCCCCCN1CCNCC12CCCC2 |
| InChI | InChI=1S/C18H36N2/c1-2-3-4-5-6-7-8-11-15-20-16-14-19-17-18(20)12-9-10-13-18/h19H,2-17H2,1H3 |
| InChIKey | NRGGAPKGVJSMLY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|