C12H24N2O2 — CID 117016400
1-(3-methoxypropyl)-3,3-dimethyl-1,4-diazocan-2-one (PubChem CID 117016400) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3,3-dimethyl-1,4-diazocan-2-one.
| Compound Name | 1-(3-methoxypropyl)-3,3-dimethyl-1,4-diazocan-2-one |
|---|---|
| PubChem CID | 117016400 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-(3-methoxypropyl)-3,3-dimethyl-1,4-diazocan-2-one |
| SMILES | COCCCN1CCCCNC(C)(C)C1=O |
| InChI | InChI=1S/C12H24N2O2/c1-12(2)11(15)14(9-6-10-16-3)8-5-4-7-13-12/h13H,4-10H2,1-3H3 |
| InChIKey | OVDHPLVJZSOJIF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|